C18H29Cl3N3O7P — CID 87276883
[7-nitro-2-[(propan-2-ylamino)methyl]-1,2,3,4-tetrahydroquinolin-6-yl]methanol;2,2,2-trichloro-1-dimethoxyphosphorylethanol (PubChem CID 87276883) has the molecular formula C18H29Cl3N3O7P and a molecular weight of 536.78 g/mol. Its IUPAC name is [7-nitro-2-[(propan-2-ylamino)methyl]-1,2,3,4-tetrahydroquinolin-6-yl]methanol;2,2,2-trichloro-1-dimethoxyphosphorylethanol.
| Compound Name | [7-nitro-2-[(propan-2-ylamino)methyl]-1,2,3,4-tetrahydroquinolin-6-yl]methanol;2,2,2-trichloro-1-dimethoxyphosphorylethanol |
|---|---|
| PubChem CID | 87276883 |
| Molecular Formula | C18H29Cl3N3O7P |
| Molecular Weight | 536.78 g/mol |
| Exact Mass | 535.08 |
| IUPAC Name | [7-nitro-2-[(propan-2-ylamino)methyl]-1,2,3,4-tetrahydroquinolin-6-yl]methanol;2,2,2-trichloro-1-dimethoxyphosphorylethanol |
| SMILES | CC(C)NCC1CCc2cc(CO)c([N+](=O)[O-])cc2N1.COP(=O)(OC)C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H21N3O3.C4H8Cl3O4P/c1-9(2)15-7-12-4-3-10-5-11(8-18)14(17(19)20)6-13(10)16-12;1-10-12(9,11-2)3(8)4(5,6)7/h5-6,9,12,15-16,18H,3-4,7-8H2,1-2H3;3,8H,1-2H3 |
| InChIKey | BOSBIOZRRQAXJL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 143.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.78 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|