C16H19BrN2O5 — CID 87280165
5-bromo-2,3,7-trihydroxy-1-(phenylmethoxyamino)-6-oxabicyclo[3.2.2]nonane-9-carbonitrile (PubChem CID 87280165) has the molecular formula C16H19BrN2O5 and a molecular weight of 399.24 g/mol. Its IUPAC name is 5-bromo-2,3,7-trihydroxy-1-(phenylmethoxyamino)-6-oxabicyclo[3.2.2]nonane-9-carbonitrile.
| Compound Name | 5-bromo-2,3,7-trihydroxy-1-(phenylmethoxyamino)-6-oxabicyclo[3.2.2]nonane-9-carbonitrile |
|---|---|
| PubChem CID | 87280165 |
| Molecular Formula | C16H19BrN2O5 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 5-bromo-2,3,7-trihydroxy-1-(phenylmethoxyamino)-6-oxabicyclo[3.2.2]nonane-9-carbonitrile |
| SMILES | N#CC1CC2(NOCc3ccccc3)C(O)OC1(Br)CC(O)C2O |
| InChI | InChI=1S/C16H19BrN2O5/c17-16-7-12(20)13(21)15(14(22)24-16,6-11(16)8-18)19-23-9-10-4-2-1-3-5-10/h1-5,11-14,19-22H,6-7,9H2 |
| InChIKey | UTXVJJZOIIHGFW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 114.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|