C18H23NO4 — CID 88555928
(1R,3S)-9-hydroxy-3,8-dimethyl-5-(phenylmethoxyamino)-2-oxabicyclo[3.3.1]non-6-ene-6-carbaldehyde (PubChem CID 88555928) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is (1R,3S)-9-hydroxy-3,8-dimethyl-5-(phenylmethoxyamino)-2-oxabicyclo[3.3.1]non-6-ene-6-carbaldehyde.
| Compound Name | (1R,3S)-9-hydroxy-3,8-dimethyl-5-(phenylmethoxyamino)-2-oxabicyclo[3.3.1]non-6-ene-6-carbaldehyde |
|---|---|
| PubChem CID | 88555928 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (1R,3S)-9-hydroxy-3,8-dimethyl-5-(phenylmethoxyamino)-2-oxabicyclo[3.3.1]non-6-ene-6-carbaldehyde |
| SMILES | CC1C=C(C=O)C2(NOCc3ccccc3)C[C@H](C)O[C@H]1C2O |
| InChI | InChI=1S/C18H23NO4/c1-12-8-15(10-20)18(9-13(2)23-16(12)17(18)21)19-22-11-14-6-4-3-5-7-14/h3-8,10,12-13,16-17,19,21H,9,11H2,1-2H3/t12?,13-,16+,17?,18?/m0/s1 |
| InChIKey | ZROMXDWVCIZLJN-QQRICMOVSA-N |
| XLogP | 1.76 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|