C15H19NO5 — CID 88561265
(3R,7S)-5-(phenylmethoxyamino)-2-oxabicyclo[3.2.2]non-8-ene-3,6,7-triol (PubChem CID 88561265) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is (3R,7S)-5-(phenylmethoxyamino)-2-oxabicyclo[3.2.2]non-8-ene-3,6,7-triol.
| Compound Name | (3R,7S)-5-(phenylmethoxyamino)-2-oxabicyclo[3.2.2]non-8-ene-3,6,7-triol |
|---|---|
| PubChem CID | 88561265 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | (3R,7S)-5-(phenylmethoxyamino)-2-oxabicyclo[3.2.2]non-8-ene-3,6,7-triol |
| SMILES | OC1[C@H](O)C2C=CC1(NOCc1ccccc1)C[C@H](O)O2 |
| InChI | InChI=1S/C15H19NO5/c17-12-8-15(7-6-11(21-12)13(18)14(15)19)16-20-9-10-4-2-1-3-5-10/h1-7,11-14,16-19H,8-9H2/t11?,12-,13-,14?,15?/m1/s1 |
| InChIKey | HCSMNEJVBRMLEL-YATPQJKZSA-N |
| XLogP | -0.15 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|