C15H21NO5 — CID 11403683
(2R,4aR,7S,8R,8aS)-2-methyl-8-(phenylmethoxyamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 11403683) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is (2R,4aR,7S,8R,8aS)-2-methyl-8-(phenylmethoxyamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (2R,4aR,7S,8R,8aS)-2-methyl-8-(phenylmethoxyamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 11403683 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (2R,4aR,7S,8R,8aS)-2-methyl-8-(phenylmethoxyamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | C[C@@H]1OC[C@H]2OC[C@@H](O)[C@@H](NOCc3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C15H21NO5/c1-10-18-9-13-15(21-10)14(12(17)8-19-13)16-20-7-11-5-3-2-4-6-11/h2-6,10,12-17H,7-9H2,1H3/t10-,12-,13-,14-,15-/m1/s1 |
| InChIKey | HPSRUKXGAIGANG-DIAXPKBXSA-N |
| XLogP | 0.60 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|