C4H6Br4 — CID 87282043
1,1,3-tribromo-2-(bromomethyl)propane (PubChem CID 87282043) has the molecular formula C4H6Br4 and a molecular weight of 373.71 g/mol. Its IUPAC name is 1,1,3-tribromo-2-(bromomethyl)propane.
| Compound Name | 1,1,3-tribromo-2-(bromomethyl)propane |
|---|---|
| PubChem CID | 87282043 |
| Molecular Formula | C4H6Br4 |
| Molecular Weight | 373.71 g/mol |
| Exact Mass | 369.72 |
| IUPAC Name | 1,1,3-tribromo-2-(bromomethyl)propane |
| SMILES | BrCC(CBr)C(Br)Br |
| InChI | InChI=1S/C4H6Br4/c5-1-3(2-6)4(7)8/h3-4H,1-2H2 |
| InChIKey | PHOADIGDDSGQDS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.71 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|