C29H46ClN5O2 — CID 87303662
(3R)-3-[(1S)-1-(3-chlorophenyl)-1-hydroxy-5-methoxypentyl]-N-cyano-N'-[1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboximidamide (PubChem CID 87303662) has the molecular formula C29H46ClN5O2 and a molecular weight of 532.17 g/mol. Its IUPAC name is (3R)-3-[(1S)-1-(3-chlorophenyl)-1-hydroxy-5-methoxypentyl]-N-cyano-N'-[1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboximidamide.
| Compound Name | (3R)-3-[(1S)-1-(3-chlorophenyl)-1-hydroxy-5-methoxypentyl]-N-cyano-N'-[1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 87303662 |
| Molecular Formula | C29H46ClN5O2 |
| Molecular Weight | 532.17 g/mol |
| Exact Mass | 531.33 |
| IUPAC Name | (3R)-3-[(1S)-1-(3-chlorophenyl)-1-hydroxy-5-methoxypentyl]-N-cyano-N'-[1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboximidamide |
| SMILES | CNCC(CC1CCCCC1)/N=C(\NC#N)N1CCC[C@@H]([C@@](O)(CCCCOC)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C29H46ClN5O2/c1-32-20-27(18-23-10-4-3-5-11-23)34-28(33-22-31)35-16-9-13-25(21-35)29(36,15-6-7-17-37-2)24-12-8-14-26(30)19-24/h8,12,14,19,23,25,27,32,36H,3-7,9-11,13,15-18,20-21H2,1-2H3,(H,33,34)/t25-,27?,29-/m1/s1 |
| InChIKey | BVKXMNLUYUVJEE-ZRFWWRLBSA-N |
| XLogP | 5.04 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.17 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|