C6H16N2O6 — CID 87307644
2-amino-2-(hydroxymethyl)propane-1,3-diol;2-nitroethanol (PubChem CID 87307644) has the molecular formula C6H16N2O6 and a molecular weight of 212.20 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-nitroethanol.
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-nitroethanol |
|---|---|
| PubChem CID | 87307644 |
| Molecular Formula | C6H16N2O6 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-nitroethanol |
| SMILES | NC(CO)(CO)CO.O=[N+]([O-])CCO |
| InChI | InChI=1S/C4H11NO3.C2H5NO3/c5-4(1-6,2-7)3-8;4-2-1-3(5)6/h6-8H,1-3,5H2;4H,1-2H2 |
| InChIKey | BDIYPRARFIUJDD-UHFFFAOYSA-N |
| XLogP | -3.08 |
| TPSA | 150.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|