C41H33F6NO4 — CID 87317298
10-methoxy-21,21-dimethyl-5-(4-morpholin-4-ylphenyl)-5-phenyl-17,19-bis(trifluoromethyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-11-ol (PubChem CID 87317298) has the molecular formula C41H33F6NO4 and a molecular weight of 717.71 g/mol. Its IUPAC name is 10-methoxy-21,21-dimethyl-5-(4-morpholin-4-ylphenyl)-5-phenyl-17,19-bis(trifluoromethyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-11-ol.
| Compound Name | 10-methoxy-21,21-dimethyl-5-(4-morpholin-4-ylphenyl)-5-phenyl-17,19-bis(trifluoromethyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-11-ol |
|---|---|
| PubChem CID | 87317298 |
| Molecular Formula | C41H33F6NO4 |
| Molecular Weight | 717.71 g/mol |
| Exact Mass | 717.23 |
| IUPAC Name | 10-methoxy-21,21-dimethyl-5-(4-morpholin-4-ylphenyl)-5-phenyl-17,19-bis(trifluoromethyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-11-ol |
| SMILES | COc1cc2c3c(c4c(c2cc1O)-c1cc(C(F)(F)F)cc(C(F)(F)F)c1C4(C)C)C=CC(c1ccccc1)(c1ccc(N2CCOCC2)cc1)O3 |
| InChI | InChI=1S/C41H33F6NO4/c1-38(2)35-30(19-25(40(42,43)44)20-31(35)41(45,46)47)34-28-21-32(49)33(50-3)22-29(28)37-27(36(34)38)13-14-39(52-37,23-7-5-4-6-8-23)24-9-11-26(12-10-24)48-15-17-51-18-16-48/h4-14,19-22,49H,15-18H2,1-3H3 |
| InChIKey | FSEMUCLRWIKEHN-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.71 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|