C13H17NO3S — CID 87324307
bicyclo[2.2.1]hept-5-ene-2-sulfonate;2-methylpyridin-1-ium (PubChem CID 87324307) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-5-ene-2-sulfonate;2-methylpyridin-1-ium.
| Compound Name | bicyclo[2.2.1]hept-5-ene-2-sulfonate;2-methylpyridin-1-ium |
|---|---|
| PubChem CID | 87324307 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | bicyclo[2.2.1]hept-5-ene-2-sulfonate;2-methylpyridin-1-ium |
| SMILES | Cc1cccc[nH+]1.O=S(=O)([O-])C1CC2C=CC1C2 |
| InChI | InChI=1S/C7H10O3S.C6H7N/c8-11(9,10)7-4-5-1-2-6(7)3-5;1-6-4-2-3-5-7-6/h1-2,5-7H,3-4H2,(H,8,9,10);2-5H,1H3 |
| InChIKey | LJSMGYQDAJZRTK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 71.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|