C14H17NO2S — CID 90661783
(1R,2R,4S)-N-benzylbicyclo[2.2.1]hept-5-ene-2-sulfonamide (PubChem CID 90661783) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is (1R,2R,4S)-N-benzylbicyclo[2.2.1]hept-5-ene-2-sulfonamide.
| Compound Name | (1R,2R,4S)-N-benzylbicyclo[2.2.1]hept-5-ene-2-sulfonamide |
|---|---|
| PubChem CID | 90661783 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | (1R,2R,4S)-N-benzylbicyclo[2.2.1]hept-5-ene-2-sulfonamide |
| SMILES | O=S(=O)(NCc1ccccc1)[C@@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C14H17NO2S/c16-18(17,14-9-12-6-7-13(14)8-12)15-10-11-4-2-1-3-5-11/h1-7,12-15H,8-10H2/t12-,13-,14+/m0/s1 |
| InChIKey | NOCWGSIZBZCLJQ-MELADBBJSA-N |
| XLogP | 2.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|