About N,N'-difluoro-N,N'-diphenylethane-1,2-diamine
N,N'-difluoro-N,N'-diphenylethane-1,2-diamine (PubChem CID 87330644) has the molecular formula C14H14F2N2
and a molecular weight of 248.28 g/mol. Its IUPAC name is N,N'-difluoro-N,N'-diphenylethane-1,2-diamine.
Molecular Properties
| Compound Name | N,N'-difluoro-N,N'-diphenylethane-1,2-diamine |
| PubChem CID | 87330644 |
| Molecular Formula | C14H14F2N2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N,N'-difluoro-N,N'-diphenylethane-1,2-diamine |
| SMILES | FN(CCN(F)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H14F2N2/c15-17(13-7-3-1-4-8-13)11-12-18(16)14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | DYGLXYDXLXFMEX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N,N'-difluoro-N,N'-diphenylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-difluoro-N,N'-diphenylethane-1,2-diamine?
The IUPAC name of N,N'-difluoro-N,N'-diphenylethane-1,2-diamine (CID 87330644) is N,N'-difluoro-N,N'-diphenylethane-1,2-diamine.
What is the SMILES notation for N,N'-difluoro-N,N'-diphenylethane-1,2-diamine?
The canonical SMILES for N,N'-difluoro-N,N'-diphenylethane-1,2-diamine is FN(CCN(F)c1ccccc1)c1ccccc1.
What is the InChIKey of N,N'-difluoro-N,N'-diphenylethane-1,2-diamine?
The InChIKey is DYGLXYDXLXFMEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F2N2/c15-17(13-7-3-1-4-8-13)11-12-18(16)14-9-5-2-6-10-14/h1-10H,11-12H2.
What are the key properties of N,N'-difluoro-N,N'-diphenylethane-1,2-diamine?
N,N'-difluoro-N,N'-diphenylethane-1,2-diamine has a molecular weight of 248.28 g/mol, XLogP of 3.77, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-difluoro-N,N'-diphenylethane-1,2-diamine is sourced from PubChem (CID 87330644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).