C18H20F3N3O5S — CID 87332233
tert-butyl 2-phenyl-3-(trifluoromethylsulfonyloxy)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate (PubChem CID 87332233) has the molecular formula C18H20F3N3O5S and a molecular weight of 447.44 g/mol. Its IUPAC name is tert-butyl 2-phenyl-3-(trifluoromethylsulfonyloxy)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 2-phenyl-3-(trifluoromethylsulfonyloxy)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 87332233 |
| Molecular Formula | C18H20F3N3O5S |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | tert-butyl 2-phenyl-3-(trifluoromethylsulfonyloxy)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2nn(-c3ccccc3)c(OS(=O)(=O)C(F)(F)F)c2C1 |
| InChI | InChI=1S/C18H20F3N3O5S/c1-17(2,3)28-16(25)23-10-9-14-13(11-23)15(29-30(26,27)18(19,20)21)24(22-14)12-7-5-4-6-8-12/h4-8H,9-11H2,1-3H3 |
| InChIKey | KZWGYRNUBBSNGP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|