C15H14F3N3O6S — CID 118469365
2-(4-methoxyphenyl)-3-(trifluoromethylsulfonyloxy)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylic acid (PubChem CID 118469365) has the molecular formula C15H14F3N3O6S and a molecular weight of 421.35 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-3-(trifluoromethylsulfonyloxy)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylic acid.
| Compound Name | 2-(4-methoxyphenyl)-3-(trifluoromethylsulfonyloxy)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 118469365 |
| Molecular Formula | C15H14F3N3O6S |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | 2-(4-methoxyphenyl)-3-(trifluoromethylsulfonyloxy)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylic acid |
| SMILES | COc1ccc(-n2nc3c(c2OS(=O)(=O)C(F)(F)F)CN(C(=O)O)CC3)cc1 |
| InChI | InChI=1S/C15H14F3N3O6S/c1-26-10-4-2-9(3-5-10)21-13(27-28(24,25)15(16,17)18)11-8-20(14(22)23)7-6-12(11)19-21/h2-5H,6-8H2,1H3,(H,22,23) |
| InChIKey | FZSPGEKRAICGHZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|