C7H11F4NO2 — CID 87346227
1-fluoropiperidin-1-ium;2,2,2-trifluoroacetate (PubChem CID 87346227) has the molecular formula C7H11F4NO2 and a molecular weight of 217.16 g/mol. Its IUPAC name is 1-fluoropiperidin-1-ium;2,2,2-trifluoroacetate.
| Compound Name | 1-fluoropiperidin-1-ium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87346227 |
| Molecular Formula | C7H11F4NO2 |
| Molecular Weight | 217.16 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 1-fluoropiperidin-1-ium;2,2,2-trifluoroacetate |
| SMILES | F[NH+]1CCCCC1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C5H10FN.C2HF3O2/c6-7-4-2-1-3-5-7;3-2(4,5)1(6)7/h1-5H2;(H,6,7) |
| InChIKey | CXXPZOHLIUWSNR-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.16 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|