C6H14N2O5 — CID 87361841
(2R,3S,4R,5R)-2,3-diaminooxy-4,5-dihydroxyhexanal (PubChem CID 87361841) has the molecular formula C6H14N2O5 and a molecular weight of 194.19 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3-diaminooxy-4,5-dihydroxyhexanal.
| Compound Name | (2R,3S,4R,5R)-2,3-diaminooxy-4,5-dihydroxyhexanal |
|---|---|
| PubChem CID | 87361841 |
| Molecular Formula | C6H14N2O5 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (2R,3S,4R,5R)-2,3-diaminooxy-4,5-dihydroxyhexanal |
| SMILES | C[C@@H](O)[C@@H](O)[C@H](ON)[C@H](C=O)ON |
| InChI | InChI=1S/C6H14N2O5/c1-3(10)5(11)6(13-8)4(2-9)12-7/h2-6,10-11H,7-8H2,1H3/t3-,4+,5-,6-/m1/s1 |
| InChIKey | YJCRRHCOEICIGZ-JGWLITMVSA-N |
| XLogP | -2.56 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|