About butane;hydroxy-(methylsulfonylmethoxy)-oxophosphanium
butane;hydroxy-(methylsulfonylmethoxy)-oxophosphanium (PubChem CID 87364620) has the molecular formula C6H16O5PS+
and a molecular weight of 231.23 g/mol. Its IUPAC name is butane;hydroxy-(methylsulfonylmethoxy)-oxophosphanium.
Molecular Properties
| Compound Name | butane;hydroxy-(methylsulfonylmethoxy)-oxophosphanium |
| PubChem CID | 87364620 |
| Molecular Formula | C6H16O5PS+ |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | butane;hydroxy-(methylsulfonylmethoxy)-oxophosphanium |
| SMILES | CCCC.CS(=O)(=O)CO[P+](=O)O |
| InChI | InChI=1S/C4H10.C2H5O5PS/c1-3-4-2;1-9(5,6)2-7-8(3)4/h3-4H2,1-2H3;2H2,1H3/p+1 |
| InChIKey | GQAIHNNHYJQBEN-UHFFFAOYSA-O |
| XLogP | 1.46 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butane;hydroxy-(methylsulfonylmethoxy)-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;hydroxy-(methylsulfonylmethoxy)-oxophosphanium?
The IUPAC name of butane;hydroxy-(methylsulfonylmethoxy)-oxophosphanium (CID 87364620) is butane;hydroxy-(methylsulfonylmethoxy)-oxophosphanium.
What is the SMILES notation for butane;hydroxy-(methylsulfonylmethoxy)-oxophosphanium?
The canonical SMILES for butane;hydroxy-(methylsulfonylmethoxy)-oxophosphanium is CCCC.CS(=O)(=O)CO[P+](=O)O.
What is the InChIKey of butane;hydroxy-(methylsulfonylmethoxy)-oxophosphanium?
The InChIKey is GQAIHNNHYJQBEN-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H10.C2H5O5PS/c1-3-4-2;1-9(5,6)2-7-8(3)4/h3-4H2,1-2H3;2H2,1H3/p+1.
What are the key properties of butane;hydroxy-(methylsulfonylmethoxy)-oxophosphanium?
butane;hydroxy-(methylsulfonylmethoxy)-oxophosphanium has a molecular weight of 231.23 g/mol, XLogP of 1.46, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butane;hydroxy-(methylsulfonylmethoxy)-oxophosphanium is sourced from PubChem (CID 87364620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).