C12H21ClO5S — CID 87366293
[(3S)-5-(1-chloropropylsulfonyloxy)-4,4-dimethylpent-1-en-3-yl] acetate (PubChem CID 87366293) has the molecular formula C12H21ClO5S and a molecular weight of 312.82 g/mol. Its IUPAC name is [(3S)-5-(1-chloropropylsulfonyloxy)-4,4-dimethylpent-1-en-3-yl] acetate.
| Compound Name | [(3S)-5-(1-chloropropylsulfonyloxy)-4,4-dimethylpent-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 87366293 |
| Molecular Formula | C12H21ClO5S |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | [(3S)-5-(1-chloropropylsulfonyloxy)-4,4-dimethylpent-1-en-3-yl] acetate |
| SMILES | C=C[C@H](OC(C)=O)C(C)(C)COS(=O)(=O)C(Cl)CC |
| InChI | InChI=1S/C12H21ClO5S/c1-6-10(18-9(3)14)12(4,5)8-17-19(15,16)11(13)7-2/h6,10-11H,1,7-8H2,2-5H3/t10-,11?/m0/s1 |
| InChIKey | JORVFTAXPOBCGH-VUWPPUDQSA-N |
| XLogP | 2.45 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|