C11H19ClO6S — CID 140533862
[(2R)-4-[(1R)-1-chloropropyl]sulfonyloxy-3,3-dimethyl-1-oxobutan-2-yl] acetate (PubChem CID 140533862) has the molecular formula C11H19ClO6S and a molecular weight of 314.79 g/mol. Its IUPAC name is [(2R)-4-[(1R)-1-chloropropyl]sulfonyloxy-3,3-dimethyl-1-oxobutan-2-yl] acetate.
| Compound Name | [(2R)-4-[(1R)-1-chloropropyl]sulfonyloxy-3,3-dimethyl-1-oxobutan-2-yl] acetate |
|---|---|
| PubChem CID | 140533862 |
| Molecular Formula | C11H19ClO6S |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | [(2R)-4-[(1R)-1-chloropropyl]sulfonyloxy-3,3-dimethyl-1-oxobutan-2-yl] acetate |
| SMILES | CC[C@@H](Cl)S(=O)(=O)OCC(C)(C)[C@H](C=O)OC(C)=O |
| InChI | InChI=1S/C11H19ClO6S/c1-5-10(12)19(15,16)17-7-11(3,4)9(6-13)18-8(2)14/h6,9-10H,5,7H2,1-4H3/t9-,10-/m0/s1 |
| InChIKey | PHOSXTKODOIGNW-UWVGGRQHSA-N |
| XLogP | 1.46 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|