C14H25F5O2Sn — CID 87370856
decoxy-oxo-(1,1,4,4,4-pentafluorobutyl)tin (PubChem CID 87370856) has the molecular formula C14H25F5O2Sn and a molecular weight of 439.05 g/mol. Its IUPAC name is decoxy-oxo-(1,1,4,4,4-pentafluorobutyl)tin.
| Compound Name | decoxy-oxo-(1,1,4,4,4-pentafluorobutyl)tin |
|---|---|
| PubChem CID | 87370856 |
| Molecular Formula | C14H25F5O2Sn |
| Molecular Weight | 439.05 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | decoxy-oxo-(1,1,4,4,4-pentafluorobutyl)tin |
| SMILES | CCCCCCCCCCO[Sn](=O)C(F)(F)CCC(F)(F)F |
| InChI | InChI=1S/C10H21O.C4H4F5.O.Sn/c1-2-3-4-5-6-7-8-9-10-11;5-3(6)1-2-4(7,8)9;;/h2-10H2,1H3;1-2H2;;/q-1;;;+1 |
| InChIKey | XAPQEWLQXSMOEJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.05 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|