C24H27BrN2O6 — CID 87380618
4-bromo-N-ethyl-N-(4-phenylmethoxycarbonyl-1,8-dioxa-4-azaspiro[4.5]decane-3-carbonyl)benzeneamine oxide (PubChem CID 87380618) has the molecular formula C24H27BrN2O6 and a molecular weight of 519.39 g/mol. Its IUPAC name is 4-bromo-N-ethyl-N-(4-phenylmethoxycarbonyl-1,8-dioxa-4-azaspiro[4.5]decane-3-carbonyl)benzeneamine oxide.
| Compound Name | 4-bromo-N-ethyl-N-(4-phenylmethoxycarbonyl-1,8-dioxa-4-azaspiro[4.5]decane-3-carbonyl)benzeneamine oxide |
|---|---|
| PubChem CID | 87380618 |
| Molecular Formula | C24H27BrN2O6 |
| Molecular Weight | 519.39 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | 4-bromo-N-ethyl-N-(4-phenylmethoxycarbonyl-1,8-dioxa-4-azaspiro[4.5]decane-3-carbonyl)benzeneamine oxide |
| SMILES | CC[N+]([O-])(C(=O)C1COC2(CCOCC2)N1C(=O)OCc1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H27BrN2O6/c1-2-27(30,20-10-8-19(25)9-11-20)22(28)21-17-33-24(12-14-31-15-13-24)26(21)23(29)32-16-18-6-4-3-5-7-18/h3-11,21H,2,12-17H2,1H3 |
| InChIKey | HRUBQVPCSAKVHD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|