C19H23N3O4S — CID 87386531
2-tert-butyl-4-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]piperazine-1-carboxylic acid (PubChem CID 87386531) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is 2-tert-butyl-4-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]piperazine-1-carboxylic acid.
| Compound Name | 2-tert-butyl-4-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87386531 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-tert-butyl-4-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]piperazine-1-carboxylic acid |
| SMILES | CC(C)(C)C1CN(c2ccccc2/C=C2\SC(=O)NC2=O)CCN1C(=O)O |
| InChI | InChI=1S/C19H23N3O4S/c1-19(2,3)15-11-21(8-9-22(15)18(25)26)13-7-5-4-6-12(13)10-14-16(23)20-17(24)27-14/h4-7,10,15H,8-9,11H2,1-3H3,(H,25,26)(H,20,23,24)/b14-10- |
| InChIKey | RRRCBJKJJKWSAO-UVTDQMKNSA-N |
| XLogP | 3.23 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|