About lithium 2-methylpentan-1-olate
lithium 2-methylpentan-1-olate (PubChem CID 87387163) has the molecular formula C6H13LiO
and a molecular weight of 108.11 g/mol. Its IUPAC name is lithium 2-methylpentan-1-olate.
Molecular Properties
| Compound Name | lithium 2-methylpentan-1-olate |
| PubChem CID | 87387163 |
| Molecular Formula | C6H13LiO |
| Molecular Weight | 108.11 g/mol |
| Exact Mass | 108.11 |
| IUPAC Name | lithium 2-methylpentan-1-olate |
| SMILES | CCCC(C)C[O-].[Li+] |
| InChI | InChI=1S/C6H13O.Li/c1-3-4-6(2)5-7;/h6H,3-5H2,1-2H3;/q-1;+1 |
| InChIKey | RUQWYEKKZBCHMN-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.11 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze lithium 2-methylpentan-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-methylpentan-1-olate?
The IUPAC name of lithium 2-methylpentan-1-olate (CID 87387163) is lithium 2-methylpentan-1-olate.
What is the SMILES notation for lithium 2-methylpentan-1-olate?
The canonical SMILES for lithium 2-methylpentan-1-olate is CCCC(C)C[O-].[Li+].
What is the InChIKey of lithium 2-methylpentan-1-olate?
The InChIKey is RUQWYEKKZBCHMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13O.Li/c1-3-4-6(2)5-7;/h6H,3-5H2,1-2H3;/q-1;+1.
What are the key properties of lithium 2-methylpentan-1-olate?
lithium 2-methylpentan-1-olate has a molecular weight of 108.11 g/mol, XLogP of -2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-methylpentan-1-olate is sourced from PubChem (CID 87387163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).