C12H27N — CID 102003612
(2S)-2-methyl-N,N-di(propan-2-yl)pentan-1-amine (PubChem CID 102003612) has the molecular formula C12H27N and a molecular weight of 185.35 g/mol. Its IUPAC name is (2S)-2-methyl-N,N-di(propan-2-yl)pentan-1-amine.
| Compound Name | (2S)-2-methyl-N,N-di(propan-2-yl)pentan-1-amine |
|---|---|
| PubChem CID | 102003612 |
| Molecular Formula | C12H27N |
| Molecular Weight | 185.35 g/mol |
| Exact Mass | 185.21 |
| IUPAC Name | (2S)-2-methyl-N,N-di(propan-2-yl)pentan-1-amine |
| SMILES | CCC[C@H](C)CN(C(C)C)C(C)C |
| InChI | InChI=1S/C12H27N/c1-7-8-12(6)9-13(10(2)3)11(4)5/h10-12H,7-9H2,1-6H3/t12-/m0/s1 |
| InChIKey | OESLVCUDXTWKOF-LBPRGKRZSA-N |
| XLogP | 3.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |