C21H23BrO5 — CID 87391912
3-bromo-5-ethoxy-4-[[3-(oxan-2-yloxy)phenyl]methoxy]benzaldehyde (PubChem CID 87391912) has the molecular formula C21H23BrO5 and a molecular weight of 435.31 g/mol. Its IUPAC name is 3-bromo-5-ethoxy-4-[[3-(oxan-2-yloxy)phenyl]methoxy]benzaldehyde.
| Compound Name | 3-bromo-5-ethoxy-4-[[3-(oxan-2-yloxy)phenyl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 87391912 |
| Molecular Formula | C21H23BrO5 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 3-bromo-5-ethoxy-4-[[3-(oxan-2-yloxy)phenyl]methoxy]benzaldehyde |
| SMILES | CCOc1cc(C=O)cc(Br)c1OCc1cccc(OC2CCCCO2)c1 |
| InChI | InChI=1S/C21H23BrO5/c1-2-24-19-12-16(13-23)11-18(22)21(19)26-14-15-6-5-7-17(10-15)27-20-8-3-4-9-25-20/h5-7,10-13,20H,2-4,8-9,14H2,1H3 |
| InChIKey | OQBHAAMFBALDBK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|