C15H19ClN2O4S — CID 87408782
N-[2-[2-[(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]cyclopropyl]ethyl]-N-hydroxyformamide (PubChem CID 87408782) has the molecular formula C15H19ClN2O4S and a molecular weight of 358.85 g/mol. Its IUPAC name is N-[2-[2-[(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]cyclopropyl]ethyl]-N-hydroxyformamide.
| Compound Name | N-[2-[2-[(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]cyclopropyl]ethyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87408782 |
| Molecular Formula | C15H19ClN2O4S |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | N-[2-[2-[(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]cyclopropyl]ethyl]-N-hydroxyformamide |
| SMILES | O=CN(O)CCC1CC1S(=O)(=O)N1CCc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C15H19ClN2O4S/c16-14-2-1-11-4-6-18(9-13(11)7-14)23(21,22)15-8-12(15)3-5-17(20)10-19/h1-2,7,10,12,15,20H,3-6,8-9H2 |
| InChIKey | VUQKEPIYRFANMX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|