C14H19BN2O4S — CID 88886383
CID 88886383 (PubChem CID 88886383) has the molecular formula C14H19BN2O4S and a molecular weight of 322.19 g/mol.
| Compound Name | CID 88886383 |
|---|---|
| PubChem CID | 88886383 |
| Molecular Formula | C14H19BN2O4S |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)CN(S(=O)(=O)CC(C)(C)N(O)C=O)CC2 |
| InChI | InChI=1S/C14H19BN2O4S/c1-14(2,17(19)10-18)9-22(20,21)16-6-5-11-3-4-13(15)7-12(11)8-16/h3-4,7,10,19H,5-6,8-9H2,1-2H3 |
| InChIKey | NKQGILCDMDQARA-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|