C18H23F3N2O6S — CID 143448077
N-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]ethyl]-N-hydroxyformamide (PubChem CID 143448077) has the molecular formula C18H23F3N2O6S and a molecular weight of 452.45 g/mol. Its IUPAC name is N-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]ethyl]-N-hydroxyformamide.
| Compound Name | N-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]ethyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 143448077 |
| Molecular Formula | C18H23F3N2O6S |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | N-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]ethyl]-N-hydroxyformamide |
| SMILES | CC1(C)OC[C@H]([C@@H](CS(=O)(=O)N2CCc3ccc(C(F)(F)F)cc3C2)N(O)C=O)O1 |
| InChI | InChI=1S/C18H23F3N2O6S/c1-17(2)28-9-16(29-17)15(23(25)11-24)10-30(26,27)22-6-5-12-3-4-14(18(19,20)21)7-13(12)8-22/h3-4,7,11,15-16,25H,5-6,8-10H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | JIPISKQEGLKCDG-HZPDHXFCSA-N |
| XLogP | 1.76 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|