C17H21F3N2O5S — CID 16660448
N-hydroxy-N-[(1R)-1-[(2R)-oxolan-2-yl]-2-[[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]ethyl]formamide (PubChem CID 16660448) has the molecular formula C17H21F3N2O5S and a molecular weight of 422.43 g/mol. Its IUPAC name is N-hydroxy-N-[(1R)-1-[(2R)-oxolan-2-yl]-2-[[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]ethyl]formamide.
| Compound Name | N-hydroxy-N-[(1R)-1-[(2R)-oxolan-2-yl]-2-[[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]ethyl]formamide |
|---|---|
| PubChem CID | 16660448 |
| Molecular Formula | C17H21F3N2O5S |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | N-hydroxy-N-[(1R)-1-[(2R)-oxolan-2-yl]-2-[[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]ethyl]formamide |
| SMILES | O=CN(O)[C@@H](CS(=O)(=O)N1CCc2ccc(C(F)(F)F)cc2C1)[C@H]1CCCO1 |
| InChI | InChI=1S/C17H21F3N2O5S/c18-17(19,20)14-4-3-12-5-6-21(9-13(12)8-14)28(25,26)10-15(22(24)11-23)16-2-1-7-27-16/h3-4,8,11,15-16,24H,1-2,5-7,9-10H2/t15-,16+/m0/s1 |
| InChIKey | VGHDVSAUHFSSJE-JKSUJKDBSA-N |
| XLogP | 1.79 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|