About (2S)-2-amino-3-hydroxypropanoic acid;tetradecanamide
(2S)-2-amino-3-hydroxypropanoic acid;tetradecanamide (PubChem CID 87408831) has the molecular formula C17H36N2O4
and a molecular weight of 332.49 g/mol. Its IUPAC name is (2S)-2-amino-3-hydroxypropanoic acid;tetradecanamide.
Molecular Properties
| Compound Name | (2S)-2-amino-3-hydroxypropanoic acid;tetradecanamide |
| PubChem CID | 87408831 |
| Molecular Formula | C17H36N2O4 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (2S)-2-amino-3-hydroxypropanoic acid;tetradecanamide |
| SMILES | CCCCCCCCCCCCCC(N)=O.N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C14H29NO.C3H7NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;4-2(1-5)3(6)7/h2-13H2,1H3,(H2,15,16);2,5H,1,4H2,(H,6,7)/t;2-/m.0/s1 |
| InChIKey | LCXJRCBZIQYVAV-WNQIDUERSA-N |
| XLogP | 2.56 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-3-hydroxypropanoic acid;tetradecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-hydroxypropanoic acid;tetradecanamide?
The IUPAC name of (2S)-2-amino-3-hydroxypropanoic acid;tetradecanamide (CID 87408831) is (2S)-2-amino-3-hydroxypropanoic acid;tetradecanamide.
What is the SMILES notation for (2S)-2-amino-3-hydroxypropanoic acid;tetradecanamide?
The canonical SMILES for (2S)-2-amino-3-hydroxypropanoic acid;tetradecanamide is CCCCCCCCCCCCCC(N)=O.N[C@@H](CO)C(=O)O.
What is the InChIKey of (2S)-2-amino-3-hydroxypropanoic acid;tetradecanamide?
The InChIKey is LCXJRCBZIQYVAV-WNQIDUERSA-N. The full InChI is InChI=1S/C14H29NO.C3H7NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;4-2(1-5)3(6)7/h2-13H2,1H3,(H2,15,16);2,5H,1,4H2,(H,6,7)/t;2-/m.0/s1.
What are the key properties of (2S)-2-amino-3-hydroxypropanoic acid;tetradecanamide?
(2S)-2-amino-3-hydroxypropanoic acid;tetradecanamide has a molecular weight of 332.49 g/mol, XLogP of 2.56, 14 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-hydroxypropanoic acid;tetradecanamide is sourced from PubChem (CID 87408831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).