C29H47BrO2 — CID 87409381
[(4E,6E,8E,12E)-4,8,13,17,21-pentamethyldocosa-4,6,8,12,20-pentaenyl] 2-bromoacetate (PubChem CID 87409381) has the molecular formula C29H47BrO2 and a molecular weight of 507.60 g/mol. Its IUPAC name is [(4E,6E,8E,12E)-4,8,13,17,21-pentamethyldocosa-4,6,8,12,20-pentaenyl] 2-bromoacetate.
| Compound Name | [(4E,6E,8E,12E)-4,8,13,17,21-pentamethyldocosa-4,6,8,12,20-pentaenyl] 2-bromoacetate |
|---|---|
| PubChem CID | 87409381 |
| Molecular Formula | C29H47BrO2 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | [(4E,6E,8E,12E)-4,8,13,17,21-pentamethyldocosa-4,6,8,12,20-pentaenyl] 2-bromoacetate |
| SMILES | CC(C)=CCCC(C)CCC/C(C)=C/CC/C=C(C)/C=C/C=C(\C)CCCOC(=O)CBr |
| InChI | InChI=1S/C29H47BrO2/c1-24(2)13-9-16-27(5)19-10-17-25(3)14-7-8-15-26(4)18-11-20-28(6)21-12-22-32-29(31)23-30/h11,13-15,18,20,27H,7-10,12,16-17,19,21-23H2,1-6H3/b18-11+,25-14+,26-15+,28-20+ |
| InChIKey | NAUMAPKWAJNKON-YIRQTVAASA-N |
| XLogP | 9.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|