C15H24O4 — CID 87410081
3-(3-ethyloxiran-2-yl)-2-methyl-3-(1-methylcyclohexyl)oxirane-2-carboxylic acid (PubChem CID 87410081) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 3-(3-ethyloxiran-2-yl)-2-methyl-3-(1-methylcyclohexyl)oxirane-2-carboxylic acid.
| Compound Name | 3-(3-ethyloxiran-2-yl)-2-methyl-3-(1-methylcyclohexyl)oxirane-2-carboxylic acid |
|---|---|
| PubChem CID | 87410081 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 3-(3-ethyloxiran-2-yl)-2-methyl-3-(1-methylcyclohexyl)oxirane-2-carboxylic acid |
| SMILES | CCC1OC1C1(C2(C)CCCCC2)OC1(C)C(=O)O |
| InChI | InChI=1S/C15H24O4/c1-4-10-11(18-10)15(14(3,19-15)12(16)17)13(2)8-6-5-7-9-13/h10-11H,4-9H2,1-3H3,(H,16,17) |
| InChIKey | WCGBEPJUVKBWEN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 62.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|