C11H11NO5S — CID 87413262
2-propylsulfanyloxyperoxyisoindole-1,3-dione (PubChem CID 87413262) has the molecular formula C11H11NO5S and a molecular weight of 269.28 g/mol. Its IUPAC name is 2-propylsulfanyloxyperoxyisoindole-1,3-dione.
| Compound Name | 2-propylsulfanyloxyperoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 87413262 |
| Molecular Formula | C11H11NO5S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 2-propylsulfanyloxyperoxyisoindole-1,3-dione |
| SMILES | CCCSOOON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H11NO5S/c1-2-7-18-17-16-15-12-10(13)8-5-3-4-6-9(8)11(12)14/h3-6H,2,7H2,1H3 |
| InChIKey | CHQVVKLBCXBBDC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|