C32H33NO4S2 — CID 87414753
S-[4-[2-(2-methylsulfanylphenyl)-1,3-dioxoisoindol-5-yl]oxyphenyl] (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carbothioate (PubChem CID 87414753) has the molecular formula C32H33NO4S2 and a molecular weight of 559.75 g/mol. Its IUPAC name is S-[4-[2-(2-methylsulfanylphenyl)-1,3-dioxoisoindol-5-yl]oxyphenyl] (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carbothioate.
| Compound Name | S-[4-[2-(2-methylsulfanylphenyl)-1,3-dioxoisoindol-5-yl]oxyphenyl] (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carbothioate |
|---|---|
| PubChem CID | 87414753 |
| Molecular Formula | C32H33NO4S2 |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | S-[4-[2-(2-methylsulfanylphenyl)-1,3-dioxoisoindol-5-yl]oxyphenyl] (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carbothioate |
| SMILES | CSc1ccccc1N1C(=O)c2ccc(Oc3ccc(SC(=O)[C@@H]4C[C@H](C)CC[C@H]4C(C)C)cc3)cc2C1=O |
| InChI | InChI=1S/C32H33NO4S2/c1-19(2)24-15-9-20(3)17-27(24)32(36)39-23-13-10-21(11-14-23)37-22-12-16-25-26(18-22)31(35)33(30(25)34)28-7-5-6-8-29(28)38-4/h5-8,10-14,16,18-20,24,27H,9,15,17H2,1-4H3/t20-,24+,27-/m1/s1 |
| InChIKey | YLUGKVQTGDBUOJ-WMVAVLGLSA-N |
| XLogP | 8.33 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|