C7H8N3O3+ — CID 87420131
(2-amino-5-carboxy-3-pyridinyl)-methyl-oxoazanium (PubChem CID 87420131) has the molecular formula C7H8N3O3+ and a molecular weight of 182.16 g/mol. Its IUPAC name is (2-amino-5-carboxy-3-pyridinyl)-methyl-oxoazanium.
| Compound Name | (2-amino-5-carboxy-3-pyridinyl)-methyl-oxoazanium |
|---|---|
| PubChem CID | 87420131 |
| Molecular Formula | C7H8N3O3+ |
| Molecular Weight | 182.16 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (2-amino-5-carboxy-3-pyridinyl)-methyl-oxoazanium |
| SMILES | C[N+](=O)c1cc(C(=O)O)cnc1N |
| InChI | InChI=1S/C7H7N3O3/c1-10(13)5-2-4(7(11)12)3-9-6(5)8/h2-3H,1H3,(H2-,8,9,11,12,13)/p+1 |
| InChIKey | DSFXEUZFRYFVJX-UHFFFAOYSA-O |
| XLogP | 0.40 |
| TPSA | 96.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.16 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|