C9H18ClNS2 — CID 87421820
2-amino-3-(chloromethyl)-3,4,4,5-tetramethylthiolane-2-thiol (PubChem CID 87421820) has the molecular formula C9H18ClNS2 and a molecular weight of 239.84 g/mol. Its IUPAC name is 2-amino-3-(chloromethyl)-3,4,4,5-tetramethylthiolane-2-thiol.
| Compound Name | 2-amino-3-(chloromethyl)-3,4,4,5-tetramethylthiolane-2-thiol |
|---|---|
| PubChem CID | 87421820 |
| Molecular Formula | C9H18ClNS2 |
| Molecular Weight | 239.84 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-amino-3-(chloromethyl)-3,4,4,5-tetramethylthiolane-2-thiol |
| SMILES | CC1SC(N)(S)C(C)(CCl)C1(C)C |
| InChI | InChI=1S/C9H18ClNS2/c1-6-7(2,3)8(4,5-10)9(11,12)13-6/h6,12H,5,11H2,1-4H3 |
| InChIKey | SRGZYSFRENMYLZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.84 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|