C7H11ClS4 — CID 59341505
(3S,5R,8R)-3-(chloromethyl)-8-methyl-1,4,6,9-tetrathiaspiro[4.4]nonane (PubChem CID 59341505) has the molecular formula C7H11ClS4 and a molecular weight of 258.89 g/mol. Its IUPAC name is (3S,5R,8R)-3-(chloromethyl)-8-methyl-1,4,6,9-tetrathiaspiro[4.4]nonane.
| Compound Name | (3S,5R,8R)-3-(chloromethyl)-8-methyl-1,4,6,9-tetrathiaspiro[4.4]nonane |
|---|---|
| PubChem CID | 59341505 |
| Molecular Formula | C7H11ClS4 |
| Molecular Weight | 258.89 g/mol |
| Exact Mass | 257.94 |
| IUPAC Name | (3S,5R,8R)-3-(chloromethyl)-8-methyl-1,4,6,9-tetrathiaspiro[4.4]nonane |
| SMILES | C[C@@H]1CS[C@@]2(SC[C@@H](CCl)S2)S1 |
| InChI | InChI=1S/C7H11ClS4/c1-5-3-9-7(11-5)10-4-6(2-8)12-7/h5-6H,2-4H2,1H3/t5-,6-,7-/m1/s1 |
| InChIKey | VHQDPIVKLMRSRO-FSDSQADBSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.89 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|