C10H16S8 — CID 22621476
4,12-dimethyl-2,5,6,8,10,11,14,15-octathiatricyclo[7.5.2.01,7]hexadecane (PubChem CID 22621476) has the molecular formula C10H16S8 and a molecular weight of 392.77 g/mol. Its IUPAC name is 4,12-dimethyl-2,5,6,8,10,11,14,15-octathiatricyclo[7.5.2.01,7]hexadecane.
| Compound Name | 4,12-dimethyl-2,5,6,8,10,11,14,15-octathiatricyclo[7.5.2.01,7]hexadecane |
|---|---|
| PubChem CID | 22621476 |
| Molecular Formula | C10H16S8 |
| Molecular Weight | 392.77 g/mol |
| Exact Mass | 391.90 |
| IUPAC Name | 4,12-dimethyl-2,5,6,8,10,11,14,15-octathiatricyclo[7.5.2.01,7]hexadecane |
| SMILES | CC1CSC23SCC(C)SSC2SC(CS3)SS1 |
| InChI | InChI=1S/C10H16S8/c1-6-3-11-10-9(18-16-7(2)4-12-10)14-8(5-13-10)17-15-6/h6-9H,3-5H2,1-2H3 |
| InChIKey | PVDDHXLLWJZFTH-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.77 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|