C12H16S2 — CID 121011199
2-ethyl-4-methyl-2-phenyl-1,3-dithiolane (PubChem CID 121011199) has the molecular formula C12H16S2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 2-ethyl-4-methyl-2-phenyl-1,3-dithiolane.
| Compound Name | 2-ethyl-4-methyl-2-phenyl-1,3-dithiolane |
|---|---|
| PubChem CID | 121011199 |
| Molecular Formula | C12H16S2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-ethyl-4-methyl-2-phenyl-1,3-dithiolane |
| SMILES | CCC1(c2ccccc2)SCC(C)S1 |
| InChI | InChI=1S/C12H16S2/c1-3-12(13-9-10(2)14-12)11-7-5-4-6-8-11/h4-8,10H,3,9H2,1-2H3 |
| InChIKey | PAMIGGIEMPJGNN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |