C24H25PS2 — CID 101250156
[(4S,6R)-4,6-dimethyl-2-phenyl-1,3-dithian-2-yl]-diphenylphosphane (PubChem CID 101250156) has the molecular formula C24H25PS2 and a molecular weight of 408.57 g/mol. Its IUPAC name is [(4S,6R)-4,6-dimethyl-2-phenyl-1,3-dithian-2-yl]-diphenylphosphane.
| Compound Name | [(4S,6R)-4,6-dimethyl-2-phenyl-1,3-dithian-2-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 101250156 |
| Molecular Formula | C24H25PS2 |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | [(4S,6R)-4,6-dimethyl-2-phenyl-1,3-dithian-2-yl]-diphenylphosphane |
| SMILES | C[C@@H]1C[C@H](C)SC(c2ccccc2)(P(c2ccccc2)c2ccccc2)S1 |
| InChI | InChI=1S/C24H25PS2/c1-19-18-20(2)27-24(26-19,21-12-6-3-7-13-21)25(22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-17,19-20H,18H2,1-2H3/t19-,20+,24? |
| InChIKey | MOGOMHQNFQRAKL-VXMMSVGHSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|