C4H9NOS2 — CID 21163193
N-(4-methyl-1,3-dithiolan-2-yl)hydroxylamine (PubChem CID 21163193) has the molecular formula C4H9NOS2 and a molecular weight of 151.26 g/mol. Its IUPAC name is N-(4-methyl-1,3-dithiolan-2-yl)hydroxylamine.
| Compound Name | N-(4-methyl-1,3-dithiolan-2-yl)hydroxylamine |
|---|---|
| PubChem CID | 21163193 |
| Molecular Formula | C4H9NOS2 |
| Molecular Weight | 151.26 g/mol |
| Exact Mass | 151.01 |
| IUPAC Name | N-(4-methyl-1,3-dithiolan-2-yl)hydroxylamine |
| SMILES | CC1CSC(NO)S1 |
| InChI | InChI=1S/C4H9NOS2/c1-3-2-7-4(5-6)8-3/h3-6H,2H2,1H3 |
| InChIKey | UGWVWBLKIBQUBK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|