C20H12F12N2O2 — CID 87435052
2-[2,10-diamino-9-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenanthren-1-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 87435052) has the molecular formula C20H12F12N2O2 and a molecular weight of 540.30 g/mol. Its IUPAC name is 2-[2,10-diamino-9-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenanthren-1-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2,10-diamino-9-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenanthren-1-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 87435052 |
| Molecular Formula | C20H12F12N2O2 |
| Molecular Weight | 540.30 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | 2-[2,10-diamino-9-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenanthren-1-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Nc1ccc2c(c(N)c(C(O)(C(F)(F)F)C(F)(F)F)c3ccccc32)c1C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H12F12N2O2/c21-17(22,23)15(35,18(24,25)26)12-9-4-2-1-3-7(9)8-5-6-10(33)13(11(8)14(12)34)16(36,19(27,28)29)20(30,31)32/h1-6,35-36H,33-34H2 |
| InChIKey | MWKDPGUOSYFIJK-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.30 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|