C16H10F12N2O2 — CID 87435031
2-[1,6-diamino-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 87435031) has the molecular formula C16H10F12N2O2 and a molecular weight of 490.24 g/mol. Its IUPAC name is 2-[1,6-diamino-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[1,6-diamino-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 87435031 |
| Molecular Formula | C16H10F12N2O2 |
| Molecular Weight | 490.24 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | 2-[1,6-diamino-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Nc1ccc2c(N)c(C(O)(C(F)(F)F)C(F)(F)F)ccc2c1C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H10F12N2O2/c17-13(18,19)11(31,14(20,21)22)7-3-1-5-6(10(7)30)2-4-8(29)9(5)12(32,15(23,24)25)16(26,27)28/h1-4,31-32H,29-30H2 |
| InChIKey | WFGIRQCISHQVIR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.24 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|