C15H11F9N2O2 — CID 154474538
2-[1,5-diamino-6-(2,2,2-trifluoro-1-hydroxyethyl)naphthalen-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 154474538) has the molecular formula C15H11F9N2O2 and a molecular weight of 422.25 g/mol. Its IUPAC name is 2-[1,5-diamino-6-(2,2,2-trifluoro-1-hydroxyethyl)naphthalen-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[1,5-diamino-6-(2,2,2-trifluoro-1-hydroxyethyl)naphthalen-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 154474538 |
| Molecular Formula | C15H11F9N2O2 |
| Molecular Weight | 422.25 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 2-[1,5-diamino-6-(2,2,2-trifluoro-1-hydroxyethyl)naphthalen-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Nc1c(C(O)C(F)(F)F)ccc2c(N)c(C(O)(C(F)(F)F)C(F)(F)F)ccc12 |
| InChI | InChI=1S/C15H11F9N2O2/c16-13(17,18)11(27)7-2-1-6-5(9(7)25)3-4-8(10(6)26)12(28,14(19,20)21)15(22,23)24/h1-4,11,27-28H,25-26H2 |
| InChIKey | DDHCUPDXQZMYLD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.25 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|