C18H8F24N2O4 — CID 59552284
2-[2,5-diamino-3,4,6-tris(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 59552284) has the molecular formula C18H8F24N2O4 and a molecular weight of 772.22 g/mol. Its IUPAC name is 2-[2,5-diamino-3,4,6-tris(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2,5-diamino-3,4,6-tris(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 59552284 |
| Molecular Formula | C18H8F24N2O4 |
| Molecular Weight | 772.22 g/mol |
| Exact Mass | 772.01 |
| IUPAC Name | 2-[2,5-diamino-3,4,6-tris(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Nc1c(C(O)(C(F)(F)F)C(F)(F)F)c(C(O)(C(F)(F)F)C(F)(F)F)c(N)c(C(O)(C(F)(F)F)C(F)(F)F)c1C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H8F24N2O4/c19-11(20,21)7(45,12(22,23)24)1-2(8(46,13(25,26)27)14(28,29)30)6(44)4(10(48,17(37,38)39)18(40,41)42)3(5(1)43)9(47,15(31,32)33)16(34,35)36/h45-48H,43-44H2 |
| InChIKey | PGDFDYBSTCTEGN-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.22 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|