About (3-ethynylphenyl) thiohypochlorite
(3-ethynylphenyl) thiohypochlorite (PubChem CID 87439455) has the molecular formula C8H5ClS
and a molecular weight of 168.65 g/mol. Its IUPAC name is (3-ethynylphenyl) thiohypochlorite.
Molecular Properties
| Compound Name | (3-ethynylphenyl) thiohypochlorite |
| PubChem CID | 87439455 |
| Molecular Formula | C8H5ClS |
| Molecular Weight | 168.65 g/mol |
| Exact Mass | 167.98 |
| IUPAC Name | (3-ethynylphenyl) thiohypochlorite |
| SMILES | C#Cc1cccc(SCl)c1 |
| InChI | InChI=1S/C8H5ClS/c1-2-7-4-3-5-8(6-7)10-9/h1,3-6H |
| InChIKey | RLCJHDNLQGPSBO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.65 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-ethynylphenyl) thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethynylphenyl) thiohypochlorite?
The IUPAC name of (3-ethynylphenyl) thiohypochlorite (CID 87439455) is (3-ethynylphenyl) thiohypochlorite.
What is the SMILES notation for (3-ethynylphenyl) thiohypochlorite?
The canonical SMILES for (3-ethynylphenyl) thiohypochlorite is C#Cc1cccc(SCl)c1.
What is the InChIKey of (3-ethynylphenyl) thiohypochlorite?
The InChIKey is RLCJHDNLQGPSBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClS/c1-2-7-4-3-5-8(6-7)10-9/h1,3-6H.
What are the key properties of (3-ethynylphenyl) thiohypochlorite?
(3-ethynylphenyl) thiohypochlorite has a molecular weight of 168.65 g/mol, XLogP of 2.91, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethynylphenyl) thiohypochlorite is sourced from PubChem (CID 87439455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).