About CID 87451139
CID 87451139 (PubChem CID 87451139) has the molecular formula C4B2N4Zn
and a molecular weight of 191.09 g/mol.
Molecular Properties
| Compound Name | CID 87451139 |
| PubChem CID | 87451139 |
| Molecular Formula | C4B2N4Zn |
| Molecular Weight | 191.09 g/mol |
| Exact Mass | 189.96 |
| IUPAC Name | — |
| SMILES | N#C[B-]C#N.N#C[B-]C#N.[Zn+2] |
| InChI | InChI=1S/2C2BN2.Zn/c2*4-1-3-2-5;/q2*-1;+2 |
| InChIKey | BHLIXQLZEIRXKB-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.09 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87451139 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87451139?
The IUPAC name of CID 87451139 (CID 87451139) is not available.
What is the SMILES notation for CID 87451139?
The canonical SMILES for CID 87451139 is N#C[B-]C#N.N#C[B-]C#N.[Zn+2].
What is the InChIKey of CID 87451139?
The InChIKey is BHLIXQLZEIRXKB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C2BN2.Zn/c2*4-1-3-2-5;/q2*-1;+2.
What are the key properties of CID 87451139?
CID 87451139 has a molecular weight of 191.09 g/mol, XLogP of -0.70, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87451139 is sourced from PubChem (CID 87451139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).