C43H48F2O5S2 — CID 87452830
[2-[cyclohexyl(tetraphenyl)-λ6-sulfanyl]oxysulfonyl-2,2-difluoroethyl] adamantane-1-carboxylate (PubChem CID 87452830) has the molecular formula C43H48F2O5S2 and a molecular weight of 746.98 g/mol. Its IUPAC name is [2-[cyclohexyl(tetraphenyl)-λ6-sulfanyl]oxysulfonyl-2,2-difluoroethyl] adamantane-1-carboxylate.
| Compound Name | [2-[cyclohexyl(tetraphenyl)-λ6-sulfanyl]oxysulfonyl-2,2-difluoroethyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 87452830 |
| Molecular Formula | C43H48F2O5S2 |
| Molecular Weight | 746.98 g/mol |
| Exact Mass | 746.29 |
| IUPAC Name | [2-[cyclohexyl(tetraphenyl)-λ6-sulfanyl]oxysulfonyl-2,2-difluoroethyl] adamantane-1-carboxylate |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)(c1ccccc1)(c1ccccc1)C1CCCCC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C43H48F2O5S2/c44-43(45,32-49-41(46)42-29-33-26-34(30-42)28-35(27-33)31-42)51(47,48)50-52(36-16-6-1-7-17-36,37-18-8-2-9-19-37,38-20-10-3-11-21-38,39-22-12-4-13-23-39)40-24-14-5-15-25-40/h1-4,6-13,16-23,33-35,40H,5,14-15,24-32H2 |
| InChIKey | QIIKQZUOIRXIEK-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.98 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |