C8H16N2O2 — CID 87454696
1,1-diethyl-3-[(2S)-1-oxopropan-2-yl]urea (PubChem CID 87454696) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 1,1-diethyl-3-[(2S)-1-oxopropan-2-yl]urea.
| Compound Name | 1,1-diethyl-3-[(2S)-1-oxopropan-2-yl]urea |
|---|---|
| PubChem CID | 87454696 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 1,1-diethyl-3-[(2S)-1-oxopropan-2-yl]urea |
| SMILES | CCN(CC)C(=O)N[C@@H](C)C=O |
| InChI | InChI=1S/C8H16N2O2/c1-4-10(5-2)8(12)9-7(3)6-11/h6-7H,4-5H2,1-3H3,(H,9,12)/t7-/m0/s1 |
| InChIKey | VGJDQHFGCZAOMS-ZETCQYMHSA-N |
| XLogP | 0.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|