C14H26FNO6P+ — CID 87458629
[6-fluoro-3-methyl-6-[1-(2-methylpropanoyloxy)ethoxycarbonylamino]hexyl]-hydroxy-oxophosphanium (PubChem CID 87458629) has the molecular formula C14H26FNO6P+ and a molecular weight of 354.34 g/mol. Its IUPAC name is [6-fluoro-3-methyl-6-[1-(2-methylpropanoyloxy)ethoxycarbonylamino]hexyl]-hydroxy-oxophosphanium.
| Compound Name | [6-fluoro-3-methyl-6-[1-(2-methylpropanoyloxy)ethoxycarbonylamino]hexyl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 87458629 |
| Molecular Formula | C14H26FNO6P+ |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | [6-fluoro-3-methyl-6-[1-(2-methylpropanoyloxy)ethoxycarbonylamino]hexyl]-hydroxy-oxophosphanium |
| SMILES | CC(CCC(F)NC(=O)OC(C)OC(=O)C(C)C)CC[P+](=O)O |
| InChI | InChI=1S/C14H25FNO6P/c1-9(2)13(17)21-11(4)22-14(18)16-12(15)6-5-10(3)7-8-23(19)20/h9-12H,5-8H2,1-4H3,(H-,16,18,19,20)/p+1 |
| InChIKey | ZXTSUACZTYGNAI-UHFFFAOYSA-O |
| XLogP | 3.09 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|